Pyridazines and derivatives
Aobchem Ethyl 2-(2-isopropylphenyl)-2-oxoacetate | ≥95% | CAS 951888-64-5 | C13H16O3 | 10g
Ethyl 2-(2-isopropylphenyl)-2-oxoacetate | ≥95% | CAS 951888-64-5 | C13H16O3 | 10g
Aobchem 2-(4-Ethoxy-3-isopropylphenyl)-4 4 5 5-tetramethyl-1 3 2-dioxaborolane | 97% | C17H27BO3 | 1g
2-(4-Ethoxy-3-isopropylphenyl)-4 4 5 5-tetramethyl-1 3 2-dioxaborolane | 97% | C17H27BO3 | 1g
Aobchem (3-Bromo-5-isopropylphenyl)(phenyl)methanol | 95% | C16H17BrO | 500mg
(3-Bromo-5-isopropylphenyl)(phenyl)methanol | 95% | C16H17BrO | 500mg
Aobchem 2-Fluoro-1-(4-isopropylphenyl)ethanone | ≥95% | CAS 1076195-18-0 | C11H13FO | 500mg
2-Fluoro-1-(4-isopropylphenyl)ethanone | ≥95% | CAS 1076195-18-0 | C11H13FO | 500mg
Aobchem 6-Chloropyridazine-3-carboxylic acid | ≥95% | CAS 5096-73-1 | C5H3ClN2O2 | 10g
6-Chloropyridazine-3-carboxylic acid | ≥95% | CAS 5096-73-1 | C5H3ClN2O2 | 10g
eMolecules 914349-46-5 | 3-(6-Chloropyridazin-3-yl)benzoic acid | Combi-Blocks | MFCD05864817 | 234.640 | C11H7ClN2O2 | 96.000 | OC(=O)c1cccc(c1)-c1ccc(Cl)nn1 | 250mg | 205406474
3-(6-Chloropyridazin-3-yl)benzoic acid | Combi-Blocks | 914349-46-5 | MFCD05864817 | 234.640 | C11H7ClN2O2 | 96.000 | OC(=O)c1cccc(c1)-c1ccc(Cl)nn1 | 250mg | 205406474
eMolecules 4342-43-2 | 2-Methoxycyclohexan-1-amine | Combi-Blocks, Inc. | MFCD11126394 | 129.203 | C7H15NO | 95.000 | COC1CCCCC1N | 1g | 603139574
2-Methoxycyclohexan-1-amine | Combi-Blocks, Inc. | 4342-43-2 | MFCD11126394 | 129.203 | C7H15NO | 95.000 | COC1CCCCC1N | 1g | 603139574
eMolecules 1445-56-3 | Ambeed | 3-Chloropyridazine-4-carbonitrile | 1g | 572143778 | A547184 | MFCD11040160 | 139.54 | C5H2ClN3
Ambeed | (S)-2-Acetamido-N-methylpropanamide | 1g | 572865828 | A105157 | 19701-83-8 | MFCD00038238 | 144.174 | C6H12N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 303085-53-2 | 6-Chloropyridazine-3-carbaldehyde | Ambeed | MFCD10698041 | 142.540 | C5H3ClN2O | 95.000 | Clc1ccc(C=O)nn1 | 100mg | 528956448
6-Chloropyridazine-3-carbaldehyde | Ambeed | 303085-53-2 | MFCD10698041 | 142.540 | C5H3ClN2O | 95.000 | Clc1ccc(C=O)nn1 | 100mg | 528956448
eMolecules 1677-79-8 | 4-Chloropyridazin-3-ol | ChemScene | MFCD00233956 | 130.530 | C4H3ClN2O | 95.000 | Oc1nnccc1Cl | 25g | 596091461
4-Chloropyridazin-3-ol | ChemScene | 1677-79-8 | MFCD00233956 | 130.530 | C4H3ClN2O | 95.000 | Oc1nnccc1Cl | 25g | 596091461
eMolecules 20744-39-2 | 4-Aminopyridazine | AA Blocks LLC | MFCD00233975 | 95.105 | C4H5N3 | 0.000 | Nc1ccnnc1 | 10g | 784388918
4-Aminopyridazine | AA Blocks LLC | 20744-39-2 | MFCD00233975 | 95.105 | C4H5N3 | 0.000 | Nc1ccnnc1 | 10g | 784388918